Fragment 1935 / 2048
Occurence in dataset DUD cdk2
| Total | Present | Absent | |
|---|---|---|---|
| All compounds | 1779 | 6 | 1773 |
| 'active' compounds | 47 | 0 | 47 |
| 'decoy' compounds | 1732 | 6 | 1726 |
Compounds including the fragment
| 'decoy' compounds | |
|---|---|
| 1 | |
| 2 | |
| 3 | |
| 4 | |
| 5 | |
| 6 |
Matching compound: CC1=CC(=CC(=C1CC(C(=O)NC(CCCN=C(N)N)C(=O)NC(CC2=CC=CC=C2)C(=O)NC(CCCN)C(=O)N)N)C)O
| Match | Compound |
|---|---|
| Yes |
Sub and super fragments
Match  Yes (Exclusive): this sub/super fragment and the fragment always match the compound at the same location/s. I.e., the smaller fragment does not match elsewhere separately. | Sub Fragment | |
|---|---|---|
| 1 | Yes (Exclusive) | |
| 2 | Yes (Exclusive) | |
| 3 | Yes (Exclusive) | |
| 4 | Yes (Exclusive) | |
| 5 | Yes (Exclusive) | |
| 6 | Yes (Exclusive) | |
| 7 | Yes (Exclusive) |