Home > Compound

Compound CN1C2=CC=C(C=C2C(=NC(C1=O)O)C3=CC=CC=C3)Cl